C13H15ClN4O2S — CID 106092537
4-chloro-3-(methylaminomethyl)-N-(pyrimidin-4-ylmethyl)benzenesulfonamide (PubChem CID 106092537) has the molecular formula C13H15ClN4O2S and a molecular weight of 326.81 g/mol. Its IUPAC name is 4-chloro-3-(methylaminomethyl)-N-(pyrimidin-4-ylmethyl)benzenesulfonamide.
| Compound Name | 4-chloro-3-(methylaminomethyl)-N-(pyrimidin-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106092537 |
| Molecular Formula | C13H15ClN4O2S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-chloro-3-(methylaminomethyl)-N-(pyrimidin-4-ylmethyl)benzenesulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NCc2ccncn2)ccc1Cl |
| InChI | InChI=1S/C13H15ClN4O2S/c1-15-7-10-6-12(2-3-13(10)14)21(19,20)18-8-11-4-5-16-9-17-11/h2-6,9,15,18H,7-8H2,1H3 |
| InChIKey | ACLDDRUIEFDKKR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |