C13H19N5O2S — CID 106092589
5-(aminomethyl)-1-propyl-N-(pyrimidin-4-ylmethyl)pyrrole-3-sulfonamide (PubChem CID 106092589) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 5-(aminomethyl)-1-propyl-N-(pyrimidin-4-ylmethyl)pyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-1-propyl-N-(pyrimidin-4-ylmethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106092589 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 5-(aminomethyl)-1-propyl-N-(pyrimidin-4-ylmethyl)pyrrole-3-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)NCc2ccncn2)cc1CN |
| InChI | InChI=1S/C13H19N5O2S/c1-2-5-18-9-13(6-12(18)7-14)21(19,20)17-8-11-3-4-15-10-16-11/h3-4,6,9-10,17H,2,5,7-8,14H2,1H3 |
| InChIKey | FVIUDDKFMQFNMW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |