C13H25N3O2S2 — CID 106064798
5-(aminomethyl)-N-(2-methyl-3-methylsulfanylpropyl)-1-propylpyrrole-3-sulfonamide (PubChem CID 106064798) has the molecular formula C13H25N3O2S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-methyl-3-methylsulfanylpropyl)-1-propylpyrrole-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2-methyl-3-methylsulfanylpropyl)-1-propylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 106064798 |
| Molecular Formula | C13H25N3O2S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 5-(aminomethyl)-N-(2-methyl-3-methylsulfanylpropyl)-1-propylpyrrole-3-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)NCC(C)CSC)cc1CN |
| InChI | InChI=1S/C13H25N3O2S2/c1-4-5-16-9-13(6-12(16)7-14)20(17,18)15-8-11(2)10-19-3/h6,9,11,15H,4-5,7-8,10,14H2,1-3H3 |
| InChIKey | AVYBYDHCSHBRLR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |