C11H14N4O2S2 — CID 106092583
2-(methylaminomethyl)-N-(pyrimidin-4-ylmethyl)thiophene-3-sulfonamide (PubChem CID 106092583) has the molecular formula C11H14N4O2S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-(methylaminomethyl)-N-(pyrimidin-4-ylmethyl)thiophene-3-sulfonamide.
| Compound Name | 2-(methylaminomethyl)-N-(pyrimidin-4-ylmethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106092583 |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(methylaminomethyl)-N-(pyrimidin-4-ylmethyl)thiophene-3-sulfonamide |
| SMILES | CNCc1sccc1S(=O)(=O)NCc1ccncn1 |
| InChI | InChI=1S/C11H14N4O2S2/c1-12-7-10-11(3-5-18-10)19(16,17)15-6-9-2-4-13-8-14-9/h2-5,8,12,15H,6-7H2,1H3 |
| InChIKey | CAUHHZZNSCEJTA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |