C11H14ClN5O3S — CID 106373397
5-chloro-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinylpyridine-3-sulfonamide (PubChem CID 106373397) has the molecular formula C11H14ClN5O3S and a molecular weight of 331.79 g/mol. Its IUPAC name is 5-chloro-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinylpyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106373397 |
| Molecular Formula | C11H14ClN5O3S |
| Molecular Weight | 331.79 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 5-chloro-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-hydrazinylpyridine-3-sulfonamide |
| SMILES | Cc1nc(CNS(=O)(=O)c2cnc(NN)c(Cl)c2)oc1C |
| InChI | InChI=1S/C11H14ClN5O3S/c1-6-7(2)20-10(16-6)5-15-21(18,19)8-3-9(12)11(17-13)14-4-8/h3-4,15H,5,13H2,1-2H3,(H,14,17) |
| InChIKey | UILNOBUHOKTGKF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.79 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|