C10H8BrClN2O3S — CID 79477882
4-bromo-2-chloro-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide (PubChem CID 79477882) has the molecular formula C10H8BrClN2O3S and a molecular weight of 351.61 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-chloro-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79477882 |
| Molecular Formula | C10H8BrClN2O3S |
| Molecular Weight | 351.61 g/mol |
| Exact Mass | 349.91 |
| IUPAC Name | 4-bromo-2-chloro-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccon1)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C10H8BrClN2O3S/c11-7-1-2-10(9(12)5-7)18(15,16)13-6-8-3-4-17-14-8/h1-5,13H,6H2 |
| InChIKey | AVPFWDLOXILHGR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |