C11H11BrN2O3S — CID 79477683
5-bromo-2-methyl-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide (PubChem CID 79477683) has the molecular formula C11H11BrN2O3S and a molecular weight of 331.19 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide.
| Compound Name | 5-bromo-2-methyl-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79477683 |
| Molecular Formula | C11H11BrN2O3S |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 5-bromo-2-methyl-N-(1,2-oxazol-3-ylmethyl)benzenesulfonamide |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)NCc1ccon1 |
| InChI | InChI=1S/C11H11BrN2O3S/c1-8-2-3-9(12)6-11(8)18(15,16)13-7-10-4-5-17-14-10/h2-6,13H,7H2,1H3 |
| InChIKey | FSBDXZDAWXWOHH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |