C15H11ClN4O4S2 — CID 108784357
4-chloro-3-nitro-N-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methyl]benzenesulfonamide (PubChem CID 108784357) has the molecular formula C15H11ClN4O4S2 and a molecular weight of 410.86 g/mol. Its IUPAC name is 4-chloro-3-nitro-N-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 4-chloro-3-nitro-N-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 108784357 |
| Molecular Formula | C15H11ClN4O4S2 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 4-chloro-3-nitro-N-[(2-pyridin-4-yl-1,3-thiazol-4-yl)methyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)NCc2csc(-c3ccncc3)n2)ccc1Cl |
| InChI | InChI=1S/C15H11ClN4O4S2/c16-13-2-1-12(7-14(13)20(21)22)26(23,24)18-8-11-9-25-15(19-11)10-3-5-17-6-4-10/h1-7,9,18H,8H2 |
| InChIKey | LRAZUBJSLBGFGF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|