C10H13N7O3 — CID 106303488
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-methoxy-5-nitropyrimidin-4-amine (PubChem CID 106303488) has the molecular formula C10H13N7O3 and a molecular weight of 279.26 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-methoxy-5-nitropyrimidin-4-amine.
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-methoxy-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 106303488 |
| Molecular Formula | C10H13N7O3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-6-methoxy-5-nitropyrimidin-4-amine |
| SMILES | CCn1cnnc1CNc1ncnc(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N7O3/c1-3-16-6-14-15-7(16)4-11-9-8(17(18)19)10(20-2)13-5-12-9/h5-6H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | LMZURLGGUMVALV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|