C6H8N6O4 — CID 4254994
[(6-methoxy-5-nitropyrimidin-4-yl)amino]urea (PubChem CID 4254994) has the molecular formula C6H8N6O4 and a molecular weight of 228.17 g/mol. Its IUPAC name is [(6-methoxy-5-nitropyrimidin-4-yl)amino]urea.
| Compound Name | [(6-methoxy-5-nitropyrimidin-4-yl)amino]urea |
|---|---|
| PubChem CID | 4254994 |
| Molecular Formula | C6H8N6O4 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | [(6-methoxy-5-nitropyrimidin-4-yl)amino]urea |
| SMILES | COc1ncnc(NNC(N)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H8N6O4/c1-16-5-3(12(14)15)4(8-2-9-5)10-11-6(7)13/h2H,1H3,(H3,7,11,13)(H,8,9,10) |
| InChIKey | QOVHNBVVERCVQN-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|