C10H16N4O5 — CID 107866016
2-ethyl-2-[(6-methoxy-5-nitropyrimidin-4-yl)amino]propane-1,3-diol (PubChem CID 107866016) has the molecular formula C10H16N4O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2-ethyl-2-[(6-methoxy-5-nitropyrimidin-4-yl)amino]propane-1,3-diol.
| Compound Name | 2-ethyl-2-[(6-methoxy-5-nitropyrimidin-4-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 107866016 |
| Molecular Formula | C10H16N4O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-ethyl-2-[(6-methoxy-5-nitropyrimidin-4-yl)amino]propane-1,3-diol |
| SMILES | CCC(CO)(CO)Nc1ncnc(OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H16N4O5/c1-3-10(4-15,5-16)13-8-7(14(17)18)9(19-2)12-6-11-8/h6,15-16H,3-5H2,1-2H3,(H,11,12,13) |
| InChIKey | UIXSKLSZMYXUPT-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|