C13H21N5O5 — CID 104933036
tert-butyl N-[3-[(6-methoxy-5-nitropyrimidin-4-yl)amino]propyl]carbamate (PubChem CID 104933036) has the molecular formula C13H21N5O5 and a molecular weight of 327.34 g/mol. Its IUPAC name is tert-butyl N-[3-[(6-methoxy-5-nitropyrimidin-4-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(6-methoxy-5-nitropyrimidin-4-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 104933036 |
| Molecular Formula | C13H21N5O5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | tert-butyl N-[3-[(6-methoxy-5-nitropyrimidin-4-yl)amino]propyl]carbamate |
| SMILES | COc1ncnc(NCCCNC(=O)OC(C)(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N5O5/c1-13(2,3)23-12(19)15-7-5-6-14-10-9(18(20)21)11(22-4)17-8-16-10/h8H,5-7H2,1-4H3,(H,15,19)(H,14,16,17) |
| InChIKey | FPKJZAVSOZJDRL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|