C10H17N5O5 — CID 107855728
2-[[6-(ethylamino)-5-nitropyrimidin-4-yl]amino]-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 107855728) has the molecular formula C10H17N5O5 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-[[6-(ethylamino)-5-nitropyrimidin-4-yl]amino]-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-[[6-(ethylamino)-5-nitropyrimidin-4-yl]amino]-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 107855728 |
| Molecular Formula | C10H17N5O5 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-[[6-(ethylamino)-5-nitropyrimidin-4-yl]amino]-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | CCNc1ncnc(NC(CO)(CO)CO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H17N5O5/c1-2-11-8-7(15(19)20)9(13-6-12-8)14-10(3-16,4-17)5-18/h6,16-18H,2-5H2,1H3,(H2,11,12,13,14) |
| InChIKey | GCCBIRWRJBDWTM-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 153.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|