C8H12N4O3S — CID 80884987
2-[6-(ethylamino)-5-nitropyrimidin-4-yl]sulfanylethanol (PubChem CID 80884987) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-[6-(ethylamino)-5-nitropyrimidin-4-yl]sulfanylethanol.
| Compound Name | 2-[6-(ethylamino)-5-nitropyrimidin-4-yl]sulfanylethanol |
|---|---|
| PubChem CID | 80884987 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-[6-(ethylamino)-5-nitropyrimidin-4-yl]sulfanylethanol |
| SMILES | CCNc1ncnc(SCCO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H12N4O3S/c1-2-9-7-6(12(14)15)8(11-5-10-7)16-4-3-13/h5,13H,2-4H2,1H3,(H,9,10,11) |
| InChIKey | JMQDHDKBTHQRNP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|