C13H23N5O2S — CID 80887407
6-[2-(diethylamino)ethylsulfanyl]-5-nitro-N-propylpyrimidin-4-amine (PubChem CID 80887407) has the molecular formula C13H23N5O2S and a molecular weight of 313.43 g/mol. Its IUPAC name is 6-[2-(diethylamino)ethylsulfanyl]-5-nitro-N-propylpyrimidin-4-amine.
| Compound Name | 6-[2-(diethylamino)ethylsulfanyl]-5-nitro-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80887407 |
| Molecular Formula | C13H23N5O2S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 6-[2-(diethylamino)ethylsulfanyl]-5-nitro-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(SCCN(CC)CC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H23N5O2S/c1-4-7-14-12-11(18(19)20)13(16-10-15-12)21-9-8-17(5-2)6-3/h10H,4-9H2,1-3H3,(H,14,15,16) |
| InChIKey | PMIWXVPHDWLRRB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|