C13H24N4S — CID 80891443
6-[2-(diethylamino)ethylsulfanyl]-N-ethyl-5-methylpyrimidin-4-amine (PubChem CID 80891443) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is 6-[2-(diethylamino)ethylsulfanyl]-N-ethyl-5-methylpyrimidin-4-amine.
| Compound Name | 6-[2-(diethylamino)ethylsulfanyl]-N-ethyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80891443 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 6-[2-(diethylamino)ethylsulfanyl]-N-ethyl-5-methylpyrimidin-4-amine |
| SMILES | CCNc1ncnc(SCCN(CC)CC)c1C |
| InChI | InChI=1S/C13H24N4S/c1-5-14-12-11(4)13(16-10-15-12)18-9-8-17(6-2)7-3/h10H,5-9H2,1-4H3,(H,14,15,16) |
| InChIKey | BUUNITHQTUPLTO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |