C13H23N3S — CID 107765253
5-methyl-6-pentylsulfanyl-N-propylpyrimidin-4-amine (PubChem CID 107765253) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 5-methyl-6-pentylsulfanyl-N-propylpyrimidin-4-amine.
| Compound Name | 5-methyl-6-pentylsulfanyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107765253 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 5-methyl-6-pentylsulfanyl-N-propylpyrimidin-4-amine |
| SMILES | CCCCCSc1ncnc(NCCC)c1C |
| InChI | InChI=1S/C13H23N3S/c1-4-6-7-9-17-13-11(3)12(14-8-5-2)15-10-16-13/h10H,4-9H2,1-3H3,(H,14,15,16) |
| InChIKey | KDPTWHYUZOIAJC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|