C10H17N3S — CID 80887936
6-ethylsulfanyl-5-methyl-N-propylpyrimidin-4-amine (PubChem CID 80887936) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is 6-ethylsulfanyl-5-methyl-N-propylpyrimidin-4-amine.
| Compound Name | 6-ethylsulfanyl-5-methyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80887936 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 6-ethylsulfanyl-5-methyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(SCC)c1C |
| InChI | InChI=1S/C10H17N3S/c1-4-6-11-9-8(3)10(14-5-2)13-7-12-9/h7H,4-6H2,1-3H3,(H,11,12,13) |
| InChIKey | LWUYCUMTGPXSAC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |