C13H25N5S — CID 80996460
N,N-diethyl-2-(2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-yl)sulfanylethanamine (PubChem CID 80996460) has the molecular formula C13H25N5S and a molecular weight of 283.44 g/mol. Its IUPAC name is N,N-diethyl-2-(2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-yl)sulfanylethanamine.
| Compound Name | N,N-diethyl-2-(2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-yl)sulfanylethanamine |
|---|---|
| PubChem CID | 80996460 |
| Molecular Formula | C13H25N5S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N,N-diethyl-2-(2-ethyl-6-hydrazinyl-5-methylpyrimidin-4-yl)sulfanylethanamine |
| SMILES | CCc1nc(NN)c(C)c(SCCN(CC)CC)n1 |
| InChI | InChI=1S/C13H25N5S/c1-5-11-15-12(17-14)10(4)13(16-11)19-9-8-18(6-2)7-3/h5-9,14H2,1-4H3,(H,15,16,17) |
| InChIKey | SPPWTEIFDMPMTR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|