C12H14N6O2S — CID 80883011
6-(5-methylpyrimidin-2-yl)sulfanyl-5-nitro-N-propylpyrimidin-4-amine (PubChem CID 80883011) has the molecular formula C12H14N6O2S and a molecular weight of 306.35 g/mol. Its IUPAC name is 6-(5-methylpyrimidin-2-yl)sulfanyl-5-nitro-N-propylpyrimidin-4-amine.
| Compound Name | 6-(5-methylpyrimidin-2-yl)sulfanyl-5-nitro-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80883011 |
| Molecular Formula | C12H14N6O2S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 6-(5-methylpyrimidin-2-yl)sulfanyl-5-nitro-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(Sc2ncc(C)cn2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N6O2S/c1-3-4-13-10-9(18(19)20)11(17-7-16-10)21-12-14-5-8(2)6-15-12/h5-7H,3-4H2,1-2H3,(H,13,16,17) |
| InChIKey | RWHMOKBPTDDMLG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|