C9H8N6O2S — CID 80887637
N-methyl-5-nitro-6-pyrimidin-2-ylsulfanylpyrimidin-4-amine (PubChem CID 80887637) has the molecular formula C9H8N6O2S and a molecular weight of 264.27 g/mol. Its IUPAC name is N-methyl-5-nitro-6-pyrimidin-2-ylsulfanylpyrimidin-4-amine.
| Compound Name | N-methyl-5-nitro-6-pyrimidin-2-ylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80887637 |
| Molecular Formula | C9H8N6O2S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | N-methyl-5-nitro-6-pyrimidin-2-ylsulfanylpyrimidin-4-amine |
| SMILES | CNc1ncnc(Sc2ncccn2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N6O2S/c1-10-7-6(15(16)17)8(14-5-13-7)18-9-11-3-2-4-12-9/h2-5H,1H3,(H,10,13,14) |
| InChIKey | VRDBLRFLPSBYEA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|