C8H8N6O2S2 — CID 112726508
N-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine (PubChem CID 112726508) has the molecular formula C8H8N6O2S2 and a molecular weight of 284.33 g/mol. Its IUPAC name is N-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine.
| Compound Name | N-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 112726508 |
| Molecular Formula | C8H8N6O2S2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | N-methyl-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-5-nitropyrimidin-4-amine |
| SMILES | CNc1ncnc(Sc2nnc(C)s2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8N6O2S2/c1-4-12-13-8(17-4)18-7-5(14(15)16)6(9-2)10-3-11-7/h3H,1-2H3,(H,9,10,11) |
| InChIKey | PKWKWYWEZWQNFL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|