C9H10N8O2S — CID 38741243
6-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methyl-5-nitropyrimidin-4-amine (PubChem CID 38741243) has the molecular formula C9H10N8O2S and a molecular weight of 294.30 g/mol. Its IUPAC name is 6-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methyl-5-nitropyrimidin-4-amine.
| Compound Name | 6-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 38741243 |
| Molecular Formula | C9H10N8O2S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 6-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methyl-5-nitropyrimidin-4-amine |
| SMILES | CNc1ncnc(Sc2nnnn2C2CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10N8O2S/c1-10-7-6(17(18)19)8(12-4-11-7)20-9-13-14-15-16(9)5-2-3-5/h4-5H,2-3H2,1H3,(H,10,11,12) |
| InChIKey | WNGOSWIOFNSDAX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|