C9H12N8S — CID 80930542
[6-(1-cyclopropyltetrazol-5-yl)sulfanyl-5-methylpyrimidin-4-yl]hydrazine (PubChem CID 80930542) has the molecular formula C9H12N8S and a molecular weight of 264.32 g/mol. Its IUPAC name is [6-(1-cyclopropyltetrazol-5-yl)sulfanyl-5-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(1-cyclopropyltetrazol-5-yl)sulfanyl-5-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80930542 |
| Molecular Formula | C9H12N8S |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | [6-(1-cyclopropyltetrazol-5-yl)sulfanyl-5-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1c(NN)ncnc1Sc1nnnn1C1CC1 |
| InChI | InChI=1S/C9H12N8S/c1-5-7(13-10)11-4-12-8(5)18-9-14-15-16-17(9)6-2-3-6/h4,6H,2-3,10H2,1H3,(H,11,12,13) |
| InChIKey | LXVBXKBVYMHAIM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|