C13H19N7S — CID 80870012
6-(1-cyclopentyltetrazol-5-yl)sulfanyl-5-ethyl-N-methylpyrimidin-4-amine (PubChem CID 80870012) has the molecular formula C13H19N7S and a molecular weight of 305.41 g/mol. Its IUPAC name is 6-(1-cyclopentyltetrazol-5-yl)sulfanyl-5-ethyl-N-methylpyrimidin-4-amine.
| Compound Name | 6-(1-cyclopentyltetrazol-5-yl)sulfanyl-5-ethyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80870012 |
| Molecular Formula | C13H19N7S |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 6-(1-cyclopentyltetrazol-5-yl)sulfanyl-5-ethyl-N-methylpyrimidin-4-amine |
| SMILES | CCc1c(NC)ncnc1Sc1nnnn1C1CCCC1 |
| InChI | InChI=1S/C13H19N7S/c1-3-10-11(14-2)15-8-16-12(10)21-13-17-18-19-20(13)9-6-4-5-7-9/h8-9H,3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | WCIVFBYPPUNQIW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |