C13H19N7S — CID 80869111
4-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-propylpyrimidin-2-amine (PubChem CID 80869111) has the molecular formula C13H19N7S and a molecular weight of 305.41 g/mol. Its IUPAC name is 4-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-propylpyrimidin-2-amine.
| Compound Name | 4-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80869111 |
| Molecular Formula | C13H19N7S |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-(1-cyclopentyltetrazol-5-yl)sulfanyl-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1nccc(Sc2nnnn2C2CCCC2)n1 |
| InChI | InChI=1S/C13H19N7S/c1-2-8-14-12-15-9-7-11(16-12)21-13-17-18-19-20(13)10-5-3-4-6-10/h7,9-10H,2-6,8H2,1H3,(H,14,15,16) |
| InChIKey | ARNYNAJXKUJETD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |