C12H17N7S — CID 80893017
4-(1-cyclopropyltetrazol-5-yl)sulfanyl-6-methyl-N-propylpyrimidin-2-amine (PubChem CID 80893017) has the molecular formula C12H17N7S and a molecular weight of 291.38 g/mol. Its IUPAC name is 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-6-methyl-N-propylpyrimidin-2-amine.
| Compound Name | 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-6-methyl-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80893017 |
| Molecular Formula | C12H17N7S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-6-methyl-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1nc(C)cc(Sc2nnnn2C2CC2)n1 |
| InChI | InChI=1S/C12H17N7S/c1-3-6-13-11-14-8(2)7-10(15-11)20-12-16-17-18-19(12)9-4-5-9/h7,9H,3-6H2,1-2H3,(H,13,14,15) |
| InChIKey | LNKOWIDEFYZACP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |