C14H18BrN5S — CID 63804436
N-[[4-bromo-2-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]methyl]propan-1-amine (PubChem CID 63804436) has the molecular formula C14H18BrN5S and a molecular weight of 368.30 g/mol. Its IUPAC name is N-[[4-bromo-2-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-bromo-2-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63804436 |
| Molecular Formula | C14H18BrN5S |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | N-[[4-bromo-2-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(Br)cc1Sc1nnnn1C1CC1 |
| InChI | InChI=1S/C14H18BrN5S/c1-2-7-16-9-10-3-4-11(15)8-13(10)21-14-17-18-19-20(14)12-5-6-12/h3-4,8,12,16H,2,5-7,9H2,1H3 |
| InChIKey | CVNCCWTYIVGAOA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|