C13H16ClN5S — CID 114864111
N-[[5-chloro-2-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]methyl]ethanamine (PubChem CID 114864111) has the molecular formula C13H16ClN5S and a molecular weight of 309.83 g/mol. Its IUPAC name is N-[[5-chloro-2-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]methyl]ethanamine.
| Compound Name | N-[[5-chloro-2-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 114864111 |
| Molecular Formula | C13H16ClN5S |
| Molecular Weight | 309.83 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-[[5-chloro-2-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(Cl)ccc1Sc1nnnn1C1CC1 |
| InChI | InChI=1S/C13H16ClN5S/c1-2-15-8-9-7-10(14)3-6-12(9)20-13-16-17-18-19(13)11-4-5-11/h3,6-7,11,15H,2,4-5,8H2,1H3 |
| InChIKey | RFIVQOKTOVVXPY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |