C11H10BrFN4S — CID 47124353
5-[(4-bromo-2-fluorophenyl)methylsulfanyl]-1-cyclopropyltetrazole (PubChem CID 47124353) has the molecular formula C11H10BrFN4S and a molecular weight of 329.20 g/mol. Its IUPAC name is 5-[(4-bromo-2-fluorophenyl)methylsulfanyl]-1-cyclopropyltetrazole.
| Compound Name | 5-[(4-bromo-2-fluorophenyl)methylsulfanyl]-1-cyclopropyltetrazole |
|---|---|
| PubChem CID | 47124353 |
| Molecular Formula | C11H10BrFN4S |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 5-[(4-bromo-2-fluorophenyl)methylsulfanyl]-1-cyclopropyltetrazole |
| SMILES | Fc1cc(Br)ccc1CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C11H10BrFN4S/c12-8-2-1-7(10(13)5-8)6-18-11-14-15-16-17(11)9-3-4-9/h1-2,5,9H,3-4,6H2 |
| InChIKey | YOWKLPBJLCBRKA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |