C13H13BrF2N4S — CID 106270154
5-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]-1-cyclopentyltetrazole (PubChem CID 106270154) has the molecular formula C13H13BrF2N4S and a molecular weight of 375.24 g/mol. Its IUPAC name is 5-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]-1-cyclopentyltetrazole.
| Compound Name | 5-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]-1-cyclopentyltetrazole |
|---|---|
| PubChem CID | 106270154 |
| Molecular Formula | C13H13BrF2N4S |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 5-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]-1-cyclopentyltetrazole |
| SMILES | Fc1ccc(Br)c(F)c1CSc1nnnn1C1CCCC1 |
| InChI | InChI=1S/C13H13BrF2N4S/c14-10-5-6-11(15)9(12(10)16)7-21-13-17-18-19-20(13)8-3-1-2-4-8/h5-6,8H,1-4,7H2 |
| InChIKey | IWIPVUJSPXYSOJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|