C13H16ClN5S — CID 63747150
3-chloro-2-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]aniline (PubChem CID 63747150) has the molecular formula C13H16ClN5S and a molecular weight of 309.83 g/mol. Its IUPAC name is 3-chloro-2-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]aniline.
| Compound Name | 3-chloro-2-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]aniline |
|---|---|
| PubChem CID | 63747150 |
| Molecular Formula | C13H16ClN5S |
| Molecular Weight | 309.83 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-chloro-2-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]aniline |
| SMILES | Nc1cccc(Cl)c1CSc1nnnn1C1CCCC1 |
| InChI | InChI=1S/C13H16ClN5S/c14-11-6-3-7-12(15)10(11)8-20-13-16-17-18-19(13)9-4-1-2-5-9/h3,6-7,9H,1-2,4-5,8,15H2 |
| InChIKey | NBORKQMTRHRKMY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.83 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|