C11H10N6S — CID 114769426
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-6-methylpyridine-4-carbonitrile (PubChem CID 114769426) has the molecular formula C11H10N6S and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-6-methylpyridine-4-carbonitrile.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-6-methylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114769426 |
| Molecular Formula | C11H10N6S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-6-methylpyridine-4-carbonitrile |
| SMILES | Cc1cc(C#N)cc(Sc2nnnn2C2CC2)n1 |
| InChI | InChI=1S/C11H10N6S/c1-7-4-8(6-12)5-10(13-7)18-11-14-15-16-17(11)9-2-3-9/h4-5,9H,2-3H2,1H3 |
| InChIKey | GJMAKZWSWZXCNF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |