C10H9F3N6S — CID 102720149
6-(1-cyclopropyltetrazol-5-yl)sulfanyl-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 102720149) has the molecular formula C10H9F3N6S and a molecular weight of 302.29 g/mol. Its IUPAC name is 6-(1-cyclopropyltetrazol-5-yl)sulfanyl-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(1-cyclopropyltetrazol-5-yl)sulfanyl-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102720149 |
| Molecular Formula | C10H9F3N6S |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 6-(1-cyclopropyltetrazol-5-yl)sulfanyl-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | Nc1cc(C(F)(F)F)cc(Sc2nnnn2C2CC2)n1 |
| InChI | InChI=1S/C10H9F3N6S/c11-10(12,13)5-3-7(14)15-8(4-5)20-9-16-17-18-19(9)6-1-2-6/h3-4,6H,1-2H2,(H2,14,15) |
| InChIKey | RUSGHZFZRYDNOD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |