C10H14N8S — CID 80882968
6-(1-cyclopentyltetrazol-5-yl)sulfanylpyrimidine-2,4-diamine (PubChem CID 80882968) has the molecular formula C10H14N8S and a molecular weight of 278.34 g/mol. Its IUPAC name is 6-(1-cyclopentyltetrazol-5-yl)sulfanylpyrimidine-2,4-diamine.
| Compound Name | 6-(1-cyclopentyltetrazol-5-yl)sulfanylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80882968 |
| Molecular Formula | C10H14N8S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 6-(1-cyclopentyltetrazol-5-yl)sulfanylpyrimidine-2,4-diamine |
| SMILES | Nc1cc(Sc2nnnn2C2CCCC2)nc(N)n1 |
| InChI | InChI=1S/C10H14N8S/c11-7-5-8(14-9(12)13-7)19-10-15-16-17-18(10)6-3-1-2-4-6/h5-6H,1-4H2,(H4,11,12,13,14) |
| InChIKey | BIDPXUBRHRIUEV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |