C12H13N7S — CID 107551334
2-(1-cyclopentyltetrazol-5-yl)sulfanyl-6-methylpyrimidine-4-carbonitrile (PubChem CID 107551334) has the molecular formula C12H13N7S and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 107551334 |
| Molecular Formula | C12H13N7S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-(1-cyclopentyltetrazol-5-yl)sulfanyl-6-methylpyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(Sc2nnnn2C2CCCC2)n1 |
| InChI | InChI=1S/C12H13N7S/c1-8-6-9(7-13)15-11(14-8)20-12-16-17-18-19(12)10-4-2-3-5-10/h6,10H,2-5H2,1H3 |
| InChIKey | ZTSRIUKQCMMXJZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 93.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |