C13H14N6S — CID 133391855
6-(1-cyclohexyltetrazol-5-yl)sulfanylpyridine-2-carbonitrile (PubChem CID 133391855) has the molecular formula C13H14N6S and a molecular weight of 286.36 g/mol. Its IUPAC name is 6-(1-cyclohexyltetrazol-5-yl)sulfanylpyridine-2-carbonitrile.
| Compound Name | 6-(1-cyclohexyltetrazol-5-yl)sulfanylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133391855 |
| Molecular Formula | C13H14N6S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 6-(1-cyclohexyltetrazol-5-yl)sulfanylpyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(Sc2nnnn2C2CCCCC2)n1 |
| InChI | InChI=1S/C13H14N6S/c14-9-10-5-4-8-12(15-10)20-13-16-17-18-19(13)11-6-2-1-3-7-11/h4-5,8,11H,1-3,6-7H2 |
| InChIKey | ZGLMNMIWIOZZNJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |