C14H17FN4OS — CID 63814144
1-[2-(1-cyclopentyltetrazol-5-yl)sulfanyl-6-fluorophenyl]ethanol (PubChem CID 63814144) has the molecular formula C14H17FN4OS and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-[2-(1-cyclopentyltetrazol-5-yl)sulfanyl-6-fluorophenyl]ethanol.
| Compound Name | 1-[2-(1-cyclopentyltetrazol-5-yl)sulfanyl-6-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 63814144 |
| Molecular Formula | C14H17FN4OS |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-[2-(1-cyclopentyltetrazol-5-yl)sulfanyl-6-fluorophenyl]ethanol |
| SMILES | CC(O)c1c(F)cccc1Sc1nnnn1C1CCCC1 |
| InChI | InChI=1S/C14H17FN4OS/c1-9(20)13-11(15)7-4-8-12(13)21-14-16-17-18-19(14)10-5-2-3-6-10/h4,7-10,20H,2-3,5-6H2,1H3 |
| InChIKey | OUPRRERAVBFUNX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |