C13H15ClN6S — CID 62496544
2-chloro-6-(1-cyclopentyltetrazol-5-yl)sulfanylbenzenecarboximidamide (PubChem CID 62496544) has the molecular formula C13H15ClN6S and a molecular weight of 322.83 g/mol. Its IUPAC name is 2-chloro-6-(1-cyclopentyltetrazol-5-yl)sulfanylbenzenecarboximidamide.
| Compound Name | 2-chloro-6-(1-cyclopentyltetrazol-5-yl)sulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 62496544 |
| Molecular Formula | C13H15ClN6S |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-chloro-6-(1-cyclopentyltetrazol-5-yl)sulfanylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(Cl)cccc1Sc1nnnn1C1CCCC1 |
| InChI | InChI=1S/C13H15ClN6S/c14-9-6-3-7-10(11(9)12(15)16)21-13-17-18-19-20(13)8-4-1-2-5-8/h3,6-8H,1-2,4-5H2,(H3,15,16) |
| InChIKey | OARLABWXZPBXMV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|