C14H19N5S — CID 63818266
2-[2-(1-cyclopentyltetrazol-5-yl)sulfanylphenyl]ethanamine (PubChem CID 63818266) has the molecular formula C14H19N5S and a molecular weight of 289.41 g/mol. Its IUPAC name is 2-[2-(1-cyclopentyltetrazol-5-yl)sulfanylphenyl]ethanamine.
| Compound Name | 2-[2-(1-cyclopentyltetrazol-5-yl)sulfanylphenyl]ethanamine |
|---|---|
| PubChem CID | 63818266 |
| Molecular Formula | C14H19N5S |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[2-(1-cyclopentyltetrazol-5-yl)sulfanylphenyl]ethanamine |
| SMILES | NCCc1ccccc1Sc1nnnn1C1CCCC1 |
| InChI | InChI=1S/C14H19N5S/c15-10-9-11-5-1-4-8-13(11)20-14-16-17-18-19(14)12-6-2-3-7-12/h1,4-5,8,12H,2-3,6-7,9-10,15H2 |
| InChIKey | ZAALQKCIJVMRLQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |