C14H19N5S — CID 63819127
1-[2-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]butan-2-amine (PubChem CID 63819127) has the molecular formula C14H19N5S and a molecular weight of 289.41 g/mol. Its IUPAC name is 1-[2-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]butan-2-amine.
| Compound Name | 1-[2-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]butan-2-amine |
|---|---|
| PubChem CID | 63819127 |
| Molecular Formula | C14H19N5S |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-[2-(1-cyclopropyltetrazol-5-yl)sulfanylphenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccccc1Sc1nnnn1C1CC1 |
| InChI | InChI=1S/C14H19N5S/c1-2-11(15)9-10-5-3-4-6-13(10)20-14-16-17-18-19(14)12-7-8-12/h3-6,11-12H,2,7-9,15H2,1H3 |
| InChIKey | ORGCDWGMDMPNQJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |