C12H16BrN5S — CID 63819603
1-[4-bromo-2-(1-methyltetrazol-5-yl)sulfanylphenyl]butan-2-amine (PubChem CID 63819603) has the molecular formula C12H16BrN5S and a molecular weight of 342.27 g/mol. Its IUPAC name is 1-[4-bromo-2-(1-methyltetrazol-5-yl)sulfanylphenyl]butan-2-amine.
| Compound Name | 1-[4-bromo-2-(1-methyltetrazol-5-yl)sulfanylphenyl]butan-2-amine |
|---|---|
| PubChem CID | 63819603 |
| Molecular Formula | C12H16BrN5S |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 1-[4-bromo-2-(1-methyltetrazol-5-yl)sulfanylphenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(Br)cc1Sc1nnnn1C |
| InChI | InChI=1S/C12H16BrN5S/c1-3-10(14)6-8-4-5-9(13)7-11(8)19-12-15-16-17-18(12)2/h4-5,7,10H,3,6,14H2,1-2H3 |
| InChIKey | KVFHFAJEEBACJI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |