C14H16BrNS2 — CID 63835546
1-(4-bromo-2-thiophen-2-ylsulfanylphenyl)butan-2-amine (PubChem CID 63835546) has the molecular formula C14H16BrNS2 and a molecular weight of 342.33 g/mol. Its IUPAC name is 1-(4-bromo-2-thiophen-2-ylsulfanylphenyl)butan-2-amine.
| Compound Name | 1-(4-bromo-2-thiophen-2-ylsulfanylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 63835546 |
| Molecular Formula | C14H16BrNS2 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 1-(4-bromo-2-thiophen-2-ylsulfanylphenyl)butan-2-amine |
| SMILES | CCC(N)Cc1ccc(Br)cc1Sc1cccs1 |
| InChI | InChI=1S/C14H16BrNS2/c1-2-12(16)8-10-5-6-11(15)9-13(10)18-14-4-3-7-17-14/h3-7,9,12H,2,8,16H2,1H3 |
| InChIKey | OPBCVVGYRWTSGI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |