C13H18BrN5S — CID 82975688
N-[1-[4-bromo-2-(1-methyltetrazol-5-yl)sulfanylphenyl]ethyl]propan-1-amine (PubChem CID 82975688) has the molecular formula C13H18BrN5S and a molecular weight of 356.29 g/mol. Its IUPAC name is N-[1-[4-bromo-2-(1-methyltetrazol-5-yl)sulfanylphenyl]ethyl]propan-1-amine.
| Compound Name | N-[1-[4-bromo-2-(1-methyltetrazol-5-yl)sulfanylphenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 82975688 |
| Molecular Formula | C13H18BrN5S |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-[1-[4-bromo-2-(1-methyltetrazol-5-yl)sulfanylphenyl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1ccc(Br)cc1Sc1nnnn1C |
| InChI | InChI=1S/C13H18BrN5S/c1-4-7-15-9(2)11-6-5-10(14)8-12(11)20-13-16-17-18-19(13)3/h5-6,8-9,15H,4,7H2,1-3H3 |
| InChIKey | UBRYMQLCTJJLRN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |