C15H20BrN3S — CID 82976192
N-[1-[5-bromo-2-(1-methylimidazol-2-yl)sulfanylphenyl]ethyl]propan-1-amine (PubChem CID 82976192) has the molecular formula C15H20BrN3S and a molecular weight of 354.32 g/mol. Its IUPAC name is N-[1-[5-bromo-2-(1-methylimidazol-2-yl)sulfanylphenyl]ethyl]propan-1-amine.
| Compound Name | N-[1-[5-bromo-2-(1-methylimidazol-2-yl)sulfanylphenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 82976192 |
| Molecular Formula | C15H20BrN3S |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-[1-[5-bromo-2-(1-methylimidazol-2-yl)sulfanylphenyl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1cc(Br)ccc1Sc1nccn1C |
| InChI | InChI=1S/C15H20BrN3S/c1-4-7-17-11(2)13-10-12(16)5-6-14(13)20-15-18-8-9-19(15)3/h5-6,8-11,17H,4,7H2,1-3H3 |
| InChIKey | FYHKTEWYXAWCCG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |