C9H9BrN6OS — CID 137000762
4-bromo-N'-hydroxy-2-(1-methyltetrazol-5-yl)sulfanylbenzenecarboximidamide (PubChem CID 137000762) has the molecular formula C9H9BrN6OS and a molecular weight of 329.18 g/mol. Its IUPAC name is 4-bromo-N'-hydroxy-2-(1-methyltetrazol-5-yl)sulfanylbenzenecarboximidamide.
| Compound Name | 4-bromo-N'-hydroxy-2-(1-methyltetrazol-5-yl)sulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 137000762 |
| Molecular Formula | C9H9BrN6OS |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 4-bromo-N'-hydroxy-2-(1-methyltetrazol-5-yl)sulfanylbenzenecarboximidamide |
| SMILES | Cn1nnnc1Sc1cc(Br)ccc1/C(N)=N/O |
| InChI | InChI=1S/C9H9BrN6OS/c1-16-9(12-14-15-16)18-7-4-5(10)2-3-6(7)8(11)13-17/h2-4,17H,1H3,(H2,11,13) |
| InChIKey | KUYKJZWRWFGMOY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|