C11H9BrN4OS — CID 114905123
4-bromo-N'-hydroxy-2-pyrimidin-4-ylsulfanylbenzenecarboximidamide (PubChem CID 114905123) has the molecular formula C11H9BrN4OS and a molecular weight of 325.19 g/mol. Its IUPAC name is 4-bromo-N'-hydroxy-2-pyrimidin-4-ylsulfanylbenzenecarboximidamide.
| Compound Name | 4-bromo-N'-hydroxy-2-pyrimidin-4-ylsulfanylbenzenecarboximidamide |
|---|---|
| PubChem CID | 114905123 |
| Molecular Formula | C11H9BrN4OS |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 4-bromo-N'-hydroxy-2-pyrimidin-4-ylsulfanylbenzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(Br)cc1Sc1ccncn1 |
| InChI | InChI=1S/C11H9BrN4OS/c12-7-1-2-8(11(13)16-17)9(5-7)18-10-3-4-14-6-15-10/h1-6,17H,(H2,13,16) |
| InChIKey | PJYIECVMPTWAMH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|