C11H10F2N6S — CID 81293385
4-(1-cyclopropyltetrazol-5-yl)sulfanyl-3,5-difluorobenzenecarboximidamide (PubChem CID 81293385) has the molecular formula C11H10F2N6S and a molecular weight of 296.31 g/mol. Its IUPAC name is 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-3,5-difluorobenzenecarboximidamide.
| Compound Name | 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-3,5-difluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 81293385 |
| Molecular Formula | C11H10F2N6S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-3,5-difluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(Sc2nnnn2C2CC2)c(F)c1 |
| InChI | InChI=1S/C11H10F2N6S/c12-7-3-5(10(14)15)4-8(13)9(7)20-11-16-17-18-19(11)6-1-2-6/h3-4,6H,1-2H2,(H3,14,15) |
| InChIKey | WAASLYIUVLDMMG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|