C11H11FN6S — CID 63668339
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-5-fluorobenzenecarboximidamide (PubChem CID 63668339) has the molecular formula C11H11FN6S and a molecular weight of 278.32 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-5-fluorobenzenecarboximidamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-5-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 63668339 |
| Molecular Formula | C11H11FN6S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-5-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)ccc1Sc1nnnn1C1CC1 |
| InChI | InChI=1S/C11H11FN6S/c12-6-1-4-9(8(5-6)10(13)14)19-11-15-16-17-18(11)7-2-3-7/h1,4-5,7H,2-3H2,(H3,13,14) |
| InChIKey | LKDVFGMYHKDQLT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|