C10H11FN6S — CID 63291341
5-fluoro-2-[(1-methyltetrazol-5-yl)sulfanylmethyl]benzenecarboximidamide (PubChem CID 63291341) has the molecular formula C10H11FN6S and a molecular weight of 266.31 g/mol. Its IUPAC name is 5-fluoro-2-[(1-methyltetrazol-5-yl)sulfanylmethyl]benzenecarboximidamide.
| Compound Name | 5-fluoro-2-[(1-methyltetrazol-5-yl)sulfanylmethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 63291341 |
| Molecular Formula | C10H11FN6S |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 5-fluoro-2-[(1-methyltetrazol-5-yl)sulfanylmethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)ccc1CSc1nnnn1C |
| InChI | InChI=1S/C10H11FN6S/c1-17-10(14-15-16-17)18-5-6-2-3-7(11)4-8(6)9(12)13/h2-4H,5H2,1H3,(H3,12,13) |
| InChIKey | MDQVWLULNYAANC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|